C33H51Cl2N5O7 — CID 21017671
tert-butyl 3-[[3-[[3-[2-(tert-butylcarbamoylamino)-2-cyclohexylacetyl]-6,6-dichloro-3-azabicyclo[3.1.0]hexane-2-carbonyl]amino]-2-oxohept-6-enoyl]amino]propanoate (PubChem CID 21017671) has the molecular formula C33H51Cl2N5O7 and a molecular weight of 700.71 g/mol. Its IUPAC name is tert-butyl 3-[[3-[[3-[2-(tert-butylcarbamoylamino)-2-cyclohexylacetyl]-6,6-dichloro-3-azabicyclo[3.1.0]hexane-2-carbonyl]amino]-2-oxohept-6-enoyl]amino]propanoate.
| Compound Name | tert-butyl 3-[[3-[[3-[2-(tert-butylcarbamoylamino)-2-cyclohexylacetyl]-6,6-dichloro-3-azabicyclo[3.1.0]hexane-2-carbonyl]amino]-2-oxohept-6-enoyl]amino]propanoate |
|---|---|
| PubChem CID | 21017671 |
| Molecular Formula | C33H51Cl2N5O7 |
| Molecular Weight | 700.71 g/mol |
| Exact Mass | 699.32 |
| IUPAC Name | tert-butyl 3-[[3-[[3-[2-(tert-butylcarbamoylamino)-2-cyclohexylacetyl]-6,6-dichloro-3-azabicyclo[3.1.0]hexane-2-carbonyl]amino]-2-oxohept-6-enoyl]amino]propanoate |
| SMILES | C=CCCC(NC(=O)C1C2C(CN1C(=O)C(NC(=O)NC(C)(C)C)C1CCCCC1)C2(Cl)Cl)C(=O)C(=O)NCCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C33H51Cl2N5O7/c1-8-9-15-21(26(42)28(44)36-17-16-22(41)47-32(5,6)7)37-27(43)25-23-20(33(23,34)35)18-40(25)29(45)24(19-13-11-10-12-14-19)38-30(46)39-31(2,3)4/h8,19-21,23-25H,1,9-18H2,2-7H3,(H,36,44)(H,37,43)(H2,38,39,46) |
| InChIKey | BKZHAWCOWKVLGR-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 163.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.71 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|