C35H53Cl2N5O7 — CID 21016089
(1-methylcyclopentyl) 3-[[3-[[3-[2-(tert-butylcarbamoylamino)-2-cyclohexylacetyl]-6,6-dichloro-3-azabicyclo[3.1.0]hexane-2-carbonyl]amino]-2-oxohept-6-enoyl]amino]propanoate (PubChem CID 21016089) has the molecular formula C35H53Cl2N5O7 and a molecular weight of 726.74 g/mol. Its IUPAC name is (1-methylcyclopentyl) 3-[[3-[[3-[2-(tert-butylcarbamoylamino)-2-cyclohexylacetyl]-6,6-dichloro-3-azabicyclo[3.1.0]hexane-2-carbonyl]amino]-2-oxohept-6-enoyl]amino]propanoate.
| Compound Name | (1-methylcyclopentyl) 3-[[3-[[3-[2-(tert-butylcarbamoylamino)-2-cyclohexylacetyl]-6,6-dichloro-3-azabicyclo[3.1.0]hexane-2-carbonyl]amino]-2-oxohept-6-enoyl]amino]propanoate |
|---|---|
| PubChem CID | 21016089 |
| Molecular Formula | C35H53Cl2N5O7 |
| Molecular Weight | 726.74 g/mol |
| Exact Mass | 725.33 |
| IUPAC Name | (1-methylcyclopentyl) 3-[[3-[[3-[2-(tert-butylcarbamoylamino)-2-cyclohexylacetyl]-6,6-dichloro-3-azabicyclo[3.1.0]hexane-2-carbonyl]amino]-2-oxohept-6-enoyl]amino]propanoate |
| SMILES | C=CCCC(NC(=O)C1C2C(CN1C(=O)C(NC(=O)NC(C)(C)C)C1CCCCC1)C2(Cl)Cl)C(=O)C(=O)NCCC(=O)OC1(C)CCCC1 |
| InChI | InChI=1S/C35H53Cl2N5O7/c1-6-7-15-23(28(44)30(46)38-19-16-24(43)49-34(5)17-11-12-18-34)39-29(45)27-25-22(35(25,36)37)20-42(27)31(47)26(21-13-9-8-10-14-21)40-32(48)41-33(2,3)4/h6,21-23,25-27H,1,7-20H2,2-5H3,(H,38,46)(H,39,45)(H2,40,41,48) |
| InChIKey | SOFCPLOSWHIDNO-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 163.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.74 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|