C36H60N4O6 — CID 162024913
propane;(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl) N-[1-cyclohexyl-2-[(2S)-2-[[1,2-dioxo-1-(prop-2-enylamino)hexan-3-yl]carbamoyl]pyrrolidin-1-yl]-2-oxoethyl]carbamate (PubChem CID 162024913) has the molecular formula C36H60N4O6 and a molecular weight of 644.90 g/mol. Its IUPAC name is propane;(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl) N-[1-cyclohexyl-2-[(2S)-2-[[1,2-dioxo-1-(prop-2-enylamino)hexan-3-yl]carbamoyl]pyrrolidin-1-yl]-2-oxoethyl]carbamate.
| Compound Name | propane;(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl) N-[1-cyclohexyl-2-[(2S)-2-[[1,2-dioxo-1-(prop-2-enylamino)hexan-3-yl]carbamoyl]pyrrolidin-1-yl]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 162024913 |
| Molecular Formula | C36H60N4O6 |
| Molecular Weight | 644.90 g/mol |
| Exact Mass | 644.45 |
| IUPAC Name | propane;(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl) N-[1-cyclohexyl-2-[(2S)-2-[[1,2-dioxo-1-(prop-2-enylamino)hexan-3-yl]carbamoyl]pyrrolidin-1-yl]-2-oxoethyl]carbamate |
| SMILES | C=CCNC(=O)C(=O)C(CCC)NC(=O)[C@@H]1CCCN1C(=O)C(NC(=O)OC1C2(C)CCC(C2)C1(C)C)C1CCCCC1.CCC |
| InChI | InChI=1S/C33H52N4O6.C3H8/c1-6-12-23(26(38)28(40)34-18-7-2)35-27(39)24-15-11-19-37(24)29(41)25(21-13-9-8-10-14-21)36-31(42)43-30-32(3,4)22-16-17-33(30,5)20-22;1-3-2/h7,21-25,30H,2,6,8-20H2,1,3-5H3,(H,34,40)(H,35,39)(H,36,42);3H2,1-2H3/t22?,23?,24-,25?,30?,33?;/m0./s1 |
| InChIKey | YVFYFMQBJYVBAD-HWLFMEOQSA-N |
| XLogP | 5.44 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.90 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|