C10H20 — CID 173056267
(E)-2,5-dimethyloct-4-ene (PubChem CID 173056267) has the molecular formula C10H20 and a molecular weight of 140.27 g/mol. Its IUPAC name is (E)-2,5-dimethyloct-4-ene.
| Compound Name | (E)-2,5-dimethyloct-4-ene |
|---|---|
| PubChem CID | 173056267 |
| Molecular Formula | C10H20 |
| Molecular Weight | 140.27 g/mol |
| Exact Mass | 140.16 |
| IUPAC Name | (E)-2,5-dimethyloct-4-ene |
| SMILES | CCC/C(C)=C/CC(C)C |
| InChI | InChI=1S/C10H20/c1-5-6-10(4)8-7-9(2)3/h8-9H,5-7H2,1-4H3/b10-8+ |
| InChIKey | XGBWZDFWOJSJID-CSKARUKUSA-N |
| XLogP | 3.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.27 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|