C9H19N — CID 178015880
(Z)-3,6-dimethylhept-3-en-1-amine (PubChem CID 178015880) has the molecular formula C9H19N and a molecular weight of 141.26 g/mol. Its IUPAC name is (Z)-3,6-dimethylhept-3-en-1-amine.
| Compound Name | (Z)-3,6-dimethylhept-3-en-1-amine |
|---|---|
| PubChem CID | 178015880 |
| Molecular Formula | C9H19N |
| Molecular Weight | 141.26 g/mol |
| Exact Mass | 141.15 |
| IUPAC Name | (Z)-3,6-dimethylhept-3-en-1-amine |
| SMILES | C/C(=C/CC(C)C)CCN |
| InChI | InChI=1S/C9H19N/c1-8(2)4-5-9(3)6-7-10/h5,8H,4,6-7,10H2,1-3H3/b9-5- |
| InChIKey | HJOIRIYVOYCXSR-UITAMQMPSA-N |
| XLogP | 2.33 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.26 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|