C20H36B — CID 174032923
CID 174032923 (PubChem CID 174032923) has the molecular formula C20H36B and a molecular weight of 287.32 g/mol.
| Compound Name | CID 174032923 |
|---|---|
| PubChem CID | 174032923 |
| Molecular Formula | C20H36B |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.29 |
| IUPAC Name | — |
| SMILES | C=C([B]/C=C\C)C(CC)(CCC)CC/C(C)=C/CC(C)C |
| InChI | InChI=1S/C20H36B/c1-8-14-20(10-3,19(7)21-16-9-2)15-13-18(6)12-11-17(4)5/h9,12,16-17H,7-8,10-11,13-15H2,1-6H3/b16-9-,18-12+ |
| InChIKey | DNDMRPZJUPCSCO-YHGCOBMBSA-N |
| XLogP | 6.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|