C21H44 — CID 171811012
(3E,5Z)-2,5-dimethylhepta-1,3,5-triene;3,3-dimethylhexane;ethane (PubChem CID 171811012) has the molecular formula C21H44 and a molecular weight of 296.58 g/mol. Its IUPAC name is (3E,5Z)-2,5-dimethylhepta-1,3,5-triene;3,3-dimethylhexane;ethane.
| Compound Name | (3E,5Z)-2,5-dimethylhepta-1,3,5-triene;3,3-dimethylhexane;ethane |
|---|---|
| PubChem CID | 171811012 |
| Molecular Formula | C21H44 |
| Molecular Weight | 296.58 g/mol |
| Exact Mass | 296.34 |
| IUPAC Name | (3E,5Z)-2,5-dimethylhepta-1,3,5-triene;3,3-dimethylhexane;ethane |
| SMILES | C=C(C)/C=C/C(C)=C\C.CC.CC.CCCC(C)(C)CC |
| InChI | InChI=1S/C9H14.C8H18.2C2H6/c1-5-9(4)7-6-8(2)3;1-5-7-8(3,4)6-2;2*1-2/h5-7H,2H2,1,3-4H3;5-7H2,1-4H3;2*1-2H3/b7-6+,9-5-;;; |
| InChIKey | HBWVEKPQNGIVCX-HRYOXHKHSA-N |
| XLogP | 8.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.58 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|