C14H24O — CID 144864848
(3Z)-2-methyl-5-(2-methylpentan-2-yloxymethyl)hexa-1,3,5-triene (PubChem CID 144864848) has the molecular formula C14H24O and a molecular weight of 208.34 g/mol. Its IUPAC name is (3Z)-2-methyl-5-(2-methylpentan-2-yloxymethyl)hexa-1,3,5-triene.
| Compound Name | (3Z)-2-methyl-5-(2-methylpentan-2-yloxymethyl)hexa-1,3,5-triene |
|---|---|
| PubChem CID | 144864848 |
| Molecular Formula | C14H24O |
| Molecular Weight | 208.34 g/mol |
| Exact Mass | 208.18 |
| IUPAC Name | (3Z)-2-methyl-5-(2-methylpentan-2-yloxymethyl)hexa-1,3,5-triene |
| SMILES | C=C(C)/C=C\C(=C)COC(C)(C)CCC |
| InChI | InChI=1S/C14H24O/c1-7-10-14(5,6)15-11-13(4)9-8-12(2)3/h8-9H,2,4,7,10-11H2,1,3,5-6H3/b9-8- |
| InChIKey | CKWDQGVABARHTJ-HJWRWDBZSA-N |
| XLogP | 4.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.34 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|