C28H48 — CID 58292421
(6E,13E,17Z)-2,6,12,12,17,20-hexamethyl-9-methylidenehenicosa-2,6,13,17-tetraene (PubChem CID 58292421) has the molecular formula C28H48 and a molecular weight of 384.69 g/mol. Its IUPAC name is (6E,13E,17Z)-2,6,12,12,17,20-hexamethyl-9-methylidenehenicosa-2,6,13,17-tetraene.
| Compound Name | (6E,13E,17Z)-2,6,12,12,17,20-hexamethyl-9-methylidenehenicosa-2,6,13,17-tetraene |
|---|---|
| PubChem CID | 58292421 |
| Molecular Formula | C28H48 |
| Molecular Weight | 384.69 g/mol |
| Exact Mass | 384.38 |
| IUPAC Name | (6E,13E,17Z)-2,6,12,12,17,20-hexamethyl-9-methylidenehenicosa-2,6,13,17-tetraene |
| SMILES | C=C(C/C=C(\C)CCC=C(C)C)CCC(C)(C)/C=C/CC/C(C)=C\CC(C)C |
| InChI | InChI=1S/C28H48/c1-23(2)13-12-15-26(6)18-19-27(7)20-22-28(8,9)21-11-10-14-25(5)17-16-24(3)4/h11,13,17-18,21,24H,7,10,12,14-16,19-20,22H2,1-6,8-9H3/b21-11+,25-17-,26-18+ |
| InChIKey | YEOKWEKNJHQQKZ-SGESSELNSA-N |
| XLogP | 9.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.69 |
| LogP ≤ 5 | 9.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|