C15H25+ — CID 101447055
(6E)-3,7,11-trimethyldodeca-1,6,10-triene (PubChem CID 101447055) has the molecular formula C15H25+ and a molecular weight of 205.36 g/mol. Its IUPAC name is (6E)-3,7,11-trimethyldodeca-1,6,10-triene.
| Compound Name | (6E)-3,7,11-trimethyldodeca-1,6,10-triene |
|---|---|
| PubChem CID | 101447055 |
| Molecular Formula | C15H25+ |
| Molecular Weight | 205.36 g/mol |
| Exact Mass | 205.20 |
| IUPAC Name | (6E)-3,7,11-trimethyldodeca-1,6,10-triene |
| SMILES | C=C[C+](C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C15H25/c1-6-14(4)10-8-12-15(5)11-7-9-13(2)3/h6,9,12H,1,7-8,10-11H2,2-5H3/q+1/b15-12+ |
| InChIKey | YVGYIOFELYQRGK-NTCAYCPXSA-N |
| XLogP | 5.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.36 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|