C38H58O6 — CID 67255151
methyl 3-[(3,4-dimethoxyphenyl)methoxy]-2-(3,8,8,14,18-pentamethyl-11-methylidenenonadeca-2,6,13,17-tetraenoxy)propanoate (PubChem CID 67255151) has the molecular formula C38H58O6 and a molecular weight of 610.88 g/mol. Its IUPAC name is methyl 3-[(3,4-dimethoxyphenyl)methoxy]-2-(3,8,8,14,18-pentamethyl-11-methylidenenonadeca-2,6,13,17-tetraenoxy)propanoate.
| Compound Name | methyl 3-[(3,4-dimethoxyphenyl)methoxy]-2-(3,8,8,14,18-pentamethyl-11-methylidenenonadeca-2,6,13,17-tetraenoxy)propanoate |
|---|---|
| PubChem CID | 67255151 |
| Molecular Formula | C38H58O6 |
| Molecular Weight | 610.88 g/mol |
| Exact Mass | 610.42 |
| IUPAC Name | methyl 3-[(3,4-dimethoxyphenyl)methoxy]-2-(3,8,8,14,18-pentamethyl-11-methylidenenonadeca-2,6,13,17-tetraenoxy)propanoate |
| SMILES | C=C(CC=C(C)CCC=C(C)C)CCC(C)(C)C=CCCC(C)=CCOC(COCc1ccc(OC)c(OC)c1)C(=O)OC |
| InChI | InChI=1S/C38H58O6/c1-29(2)14-13-16-30(3)17-18-32(5)21-24-38(6,7)23-12-11-15-31(4)22-25-44-36(37(39)42-10)28-43-27-33-19-20-34(40-8)35(26-33)41-9/h12,14,17,19-20,22-23,26,36H,5,11,13,15-16,18,21,24-25,27-28H2,1-4,6-10H3 |
| InChIKey | XCKUJJFKWAJJBN-UHFFFAOYSA-N |
| XLogP | 9.51 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.88 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|