C14H24O4 — CID 58292406
methyl (2R)-2-[(2Z)-3,7-dimethylocta-2,6-dienoxy]-3-hydroxypropanoate (PubChem CID 58292406) has the molecular formula C14H24O4 and a molecular weight of 256.34 g/mol. Its IUPAC name is methyl (2R)-2-[(2Z)-3,7-dimethylocta-2,6-dienoxy]-3-hydroxypropanoate.
| Compound Name | methyl (2R)-2-[(2Z)-3,7-dimethylocta-2,6-dienoxy]-3-hydroxypropanoate |
|---|---|
| PubChem CID | 58292406 |
| Molecular Formula | C14H24O4 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | methyl (2R)-2-[(2Z)-3,7-dimethylocta-2,6-dienoxy]-3-hydroxypropanoate |
| SMILES | COC(=O)[C@@H](CO)OC/C=C(/C)CCC=C(C)C |
| InChI | InChI=1S/C14H24O4/c1-11(2)6-5-7-12(3)8-9-18-13(10-15)14(16)17-4/h6,8,13,15H,5,7,9-10H2,1-4H3/b12-8-/t13-/m1/s1 |
| InChIKey | MGTGRNCEVBBMHK-LLBKUYECSA-N |
| XLogP | 2.23 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|