C20H29N3O5 — CID 67690860
[5-[[(2E)-3,7-dimethylocta-2,6-dienoxy]methyl]-3-methoxy-2-pyridinyl] N-(2-aminoacetyl)carbamate (PubChem CID 67690860) has the molecular formula C20H29N3O5 and a molecular weight of 391.47 g/mol. Its IUPAC name is [5-[[(2E)-3,7-dimethylocta-2,6-dienoxy]methyl]-3-methoxy-2-pyridinyl] N-(2-aminoacetyl)carbamate.
| Compound Name | [5-[[(2E)-3,7-dimethylocta-2,6-dienoxy]methyl]-3-methoxy-2-pyridinyl] N-(2-aminoacetyl)carbamate |
|---|---|
| PubChem CID | 67690860 |
| Molecular Formula | C20H29N3O5 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | [5-[[(2E)-3,7-dimethylocta-2,6-dienoxy]methyl]-3-methoxy-2-pyridinyl] N-(2-aminoacetyl)carbamate |
| SMILES | COc1cc(COC/C=C(\C)CCC=C(C)C)cnc1OC(=O)NC(=O)CN |
| InChI | InChI=1S/C20H29N3O5/c1-14(2)6-5-7-15(3)8-9-27-13-16-10-17(26-4)19(22-12-16)28-20(25)23-18(24)11-21/h6,8,10,12H,5,7,9,11,13,21H2,1-4H3,(H,23,24,25)/b15-8+ |
| InChIKey | VFFHERALQCXIQF-OVCLIPMQSA-N |
| XLogP | 2.87 |
| TPSA | 112.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|