C26H32O5 — CID 67687740
2-[4-[(2Z)-3,7-dimethylocta-2,6-dienoxy]-3,5-dimethoxyphenyl]-2-hydroxy-1-phenylethanone (PubChem CID 67687740) has the molecular formula C26H32O5 and a molecular weight of 424.54 g/mol. Its IUPAC name is 2-[4-[(2Z)-3,7-dimethylocta-2,6-dienoxy]-3,5-dimethoxyphenyl]-2-hydroxy-1-phenylethanone.
| Compound Name | 2-[4-[(2Z)-3,7-dimethylocta-2,6-dienoxy]-3,5-dimethoxyphenyl]-2-hydroxy-1-phenylethanone |
|---|---|
| PubChem CID | 67687740 |
| Molecular Formula | C26H32O5 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | 2-[4-[(2Z)-3,7-dimethylocta-2,6-dienoxy]-3,5-dimethoxyphenyl]-2-hydroxy-1-phenylethanone |
| SMILES | COc1cc(C(O)C(=O)c2ccccc2)cc(OC)c1OC/C=C(/C)CCC=C(C)C |
| InChI | InChI=1S/C26H32O5/c1-18(2)10-9-11-19(3)14-15-31-26-22(29-4)16-21(17-23(26)30-5)25(28)24(27)20-12-7-6-8-13-20/h6-8,10,12-14,16-17,25,28H,9,11,15H2,1-5H3/b19-14- |
| InChIKey | JFFOSKNCGHNNCG-RGEXLXHISA-N |
| XLogP | 5.69 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|