C21H40S — CID 143716523
5-methyl-6-pentadecan-4-yl-3,4-dihydro-2H-thiopyran (PubChem CID 143716523) has the molecular formula C21H40S and a molecular weight of 324.62 g/mol. Its IUPAC name is 5-methyl-6-pentadecan-4-yl-3,4-dihydro-2H-thiopyran.
| Compound Name | 5-methyl-6-pentadecan-4-yl-3,4-dihydro-2H-thiopyran |
|---|---|
| PubChem CID | 143716523 |
| Molecular Formula | C21H40S |
| Molecular Weight | 324.62 g/mol |
| Exact Mass | 324.29 |
| IUPAC Name | 5-methyl-6-pentadecan-4-yl-3,4-dihydro-2H-thiopyran |
| SMILES | CCCCCCCCCCCC(CCC)C1=C(C)CCCS1 |
| InChI | InChI=1S/C21H40S/c1-4-6-7-8-9-10-11-12-13-17-20(15-5-2)21-19(3)16-14-18-22-21/h20H,4-18H2,1-3H3 |
| InChIKey | FEPZLMGDTCRSEJ-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.62 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|