About 3-dodecan-6-ylthiophene
3-dodecan-6-ylthiophene (PubChem CID 129156957) has the molecular formula C16H28S
and a molecular weight of 252.47 g/mol. Its IUPAC name is 3-dodecan-6-ylthiophene.
Molecular Properties
| Compound Name | 3-dodecan-6-ylthiophene |
| PubChem CID | 129156957 |
| Molecular Formula | C16H28S |
| Molecular Weight | 252.47 g/mol |
| Exact Mass | 252.19 |
| IUPAC Name | 3-dodecan-6-ylthiophene |
| SMILES | CCCCCCC(CCCCC)c1ccsc1 |
| InChI | InChI=1S/C16H28S/c1-3-5-7-9-11-15(10-8-6-4-2)16-12-13-17-14-16/h12-15H,3-11H2,1-2H3 |
| InChIKey | MSEYNPJPUNFNFB-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 252.47 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-dodecan-6-ylthiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-dodecan-6-ylthiophene?
The IUPAC name of 3-dodecan-6-ylthiophene (CID 129156957) is 3-dodecan-6-ylthiophene.
What is the SMILES notation for 3-dodecan-6-ylthiophene?
The canonical SMILES for 3-dodecan-6-ylthiophene is CCCCCCC(CCCCC)c1ccsc1.
What is the InChIKey of 3-dodecan-6-ylthiophene?
The InChIKey is MSEYNPJPUNFNFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28S/c1-3-5-7-9-11-15(10-8-6-4-2)16-12-13-17-14-16/h12-15H,3-11H2,1-2H3.
What are the key properties of 3-dodecan-6-ylthiophene?
3-dodecan-6-ylthiophene has a molecular weight of 252.47 g/mol, XLogP of 6.38, 10 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-dodecan-6-ylthiophene is sourced from PubChem (CID 129156957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).