About disodium;3-octan-4-ylthiophene;phthalate
disodium;3-octan-4-ylthiophene;phthalate (PubChem CID 175330983) has the molecular formula C20H24Na2O4S
and a molecular weight of 406.46 g/mol. Its IUPAC name is disodium;3-octan-4-ylthiophene;phthalate.
Molecular Properties
| Compound Name | disodium;3-octan-4-ylthiophene;phthalate |
| PubChem CID | 175330983 |
| Molecular Formula | C20H24Na2O4S |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | disodium;3-octan-4-ylthiophene;phthalate |
| SMILES | CCCCC(CCC)c1ccsc1.O=C([O-])c1ccccc1C(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C12H20S.C8H6O4.2Na/c1-3-5-7-11(6-4-2)12-8-9-13-10-12;9-7(10)5-3-1-2-4-6(5)8(11)12;;/h8-11H,3-7H2,1-2H3;1-4H,(H,9,10)(H,11,12);;/q;;2*+1/p-2 |
| InChIKey | FCNSGXIHVRYZGV-UHFFFAOYSA-L |
| XLogP | -2.76 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | -2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze disodium;3-octan-4-ylthiophene;phthalate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;3-octan-4-ylthiophene;phthalate?
The IUPAC name of disodium;3-octan-4-ylthiophene;phthalate (CID 175330983) is disodium;3-octan-4-ylthiophene;phthalate.
What is the SMILES notation for disodium;3-octan-4-ylthiophene;phthalate?
The canonical SMILES for disodium;3-octan-4-ylthiophene;phthalate is CCCCC(CCC)c1ccsc1.O=C([O-])c1ccccc1C(=O)[O-].[Na+].[Na+].
What is the InChIKey of disodium;3-octan-4-ylthiophene;phthalate?
The InChIKey is FCNSGXIHVRYZGV-UHFFFAOYSA-L. The full InChI is InChI=1S/C12H20S.C8H6O4.2Na/c1-3-5-7-11(6-4-2)12-8-9-13-10-12;9-7(10)5-3-1-2-4-6(5)8(11)12;;/h8-11H,3-7H2,1-2H3;1-4H,(H,9,10)(H,11,12);;/q;;2*+1/p-2.
What are the key properties of disodium;3-octan-4-ylthiophene;phthalate?
disodium;3-octan-4-ylthiophene;phthalate has a molecular weight of 406.46 g/mol, XLogP of -2.76, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;3-octan-4-ylthiophene;phthalate is sourced from PubChem (CID 175330983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).