C22H31O2P — CID 175126933
dibutyl(diphenyl)phosphanium acetate (PubChem CID 175126933) has the molecular formula C22H31O2P and a molecular weight of 358.46 g/mol. Its IUPAC name is dibutyl(diphenyl)phosphanium acetate.
| Compound Name | dibutyl(diphenyl)phosphanium acetate |
|---|---|
| PubChem CID | 175126933 |
| Molecular Formula | C22H31O2P |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | dibutyl(diphenyl)phosphanium acetate |
| SMILES | CC(=O)[O-].CCCC[P+](CCCC)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H28P.C2H4O2/c1-3-5-17-21(18-6-4-2,19-13-9-7-10-14-19)20-15-11-8-12-16-20;1-2(3)4/h7-16H,3-6,17-18H2,1-2H3;1H3,(H,3,4)/q+1;/p-1 |
| InChIKey | VNZQXMZTTNRRNN-UHFFFAOYSA-M |
| XLogP | 4.01 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|