C31H33O3P — CID 87191199
(4-butoxyphenyl)methyl-triphenylphosphanium acetate (PubChem CID 87191199) has the molecular formula C31H33O3P and a molecular weight of 484.58 g/mol. Its IUPAC name is (4-butoxyphenyl)methyl-triphenylphosphanium acetate.
| Compound Name | (4-butoxyphenyl)methyl-triphenylphosphanium acetate |
|---|---|
| PubChem CID | 87191199 |
| Molecular Formula | C31H33O3P |
| Molecular Weight | 484.58 g/mol |
| Exact Mass | 484.22 |
| IUPAC Name | (4-butoxyphenyl)methyl-triphenylphosphanium acetate |
| SMILES | CC(=O)[O-].CCCCOc1ccc(C[P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C29H30OP.C2H4O2/c1-2-3-23-30-26-21-19-25(20-22-26)24-31(27-13-7-4-8-14-27,28-15-9-5-10-16-28)29-17-11-6-12-18-29;1-2(3)4/h4-22H,2-3,23-24H2,1H3;1H3,(H,3,4)/q+1;/p-1 |
| InChIKey | WTQWNNHNXLTNIB-UHFFFAOYSA-M |
| XLogP | 5.12 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.58 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|