About butanoate;tetraphenylphosphanium
butanoate;tetraphenylphosphanium (PubChem CID 146567473) has the molecular formula C28H27O2P
and a molecular weight of 426.50 g/mol. Its IUPAC name is butanoate;tetraphenylphosphanium.
Molecular Properties
| Compound Name | butanoate;tetraphenylphosphanium |
| PubChem CID | 146567473 |
| Molecular Formula | C28H27O2P |
| Molecular Weight | 426.50 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | butanoate;tetraphenylphosphanium |
| SMILES | CCCC(=O)[O-].c1ccc([P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H20P.C4H8O2/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;1-2-3-4(5)6/h1-20H;2-3H2,1H3,(H,5,6)/q+1;/p-1 |
| InChIKey | OULGPQBVVQIVJE-UHFFFAOYSA-M |
| XLogP | 3.84 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 426.50 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze butanoate;tetraphenylphosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butanoate;tetraphenylphosphanium?
The IUPAC name of butanoate;tetraphenylphosphanium (CID 146567473) is butanoate;tetraphenylphosphanium.
What is the SMILES notation for butanoate;tetraphenylphosphanium?
The canonical SMILES for butanoate;tetraphenylphosphanium is CCCC(=O)[O-].c1ccc([P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of butanoate;tetraphenylphosphanium?
The InChIKey is OULGPQBVVQIVJE-UHFFFAOYSA-M. The full InChI is InChI=1S/C24H20P.C4H8O2/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;1-2-3-4(5)6/h1-20H;2-3H2,1H3,(H,5,6)/q+1;/p-1.
What are the key properties of butanoate;tetraphenylphosphanium?
butanoate;tetraphenylphosphanium has a molecular weight of 426.50 g/mol, XLogP of 3.84, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butanoate;tetraphenylphosphanium is sourced from PubChem (CID 146567473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).