About diphenylstibane;2-ethylhexanoate
diphenylstibane;2-ethylhexanoate (PubChem CID 20835772) has the molecular formula C20H26O2Sb-
and a molecular weight of 420.19 g/mol. Its IUPAC name is diphenylstibane;2-ethylhexanoate.
Molecular Properties
| Compound Name | diphenylstibane;2-ethylhexanoate |
| PubChem CID | 20835772 |
| Molecular Formula | C20H26O2Sb- |
| Molecular Weight | 420.19 g/mol |
| Exact Mass | 419.10 |
| IUPAC Name | diphenylstibane;2-ethylhexanoate |
| SMILES | CCCCC(CC)C(=O)[O-].c1ccc([SbH]c2ccccc2)cc1 |
| InChI | InChI=1S/C8H16O2.2C6H5.Sb.H/c1-3-5-6-7(4-2)8(9)10;2*1-2-4-6-5-3-1;;/h7H,3-6H2,1-2H3,(H,9,10);2*1-5H;;/p-1 |
| InChIKey | TVTKADOYGNSSRT-UHFFFAOYSA-M |
| XLogP | 2.03 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 420.19 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze diphenylstibane;2-ethylhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenylstibane;2-ethylhexanoate?
The IUPAC name of diphenylstibane;2-ethylhexanoate (CID 20835772) is diphenylstibane;2-ethylhexanoate.
What is the SMILES notation for diphenylstibane;2-ethylhexanoate?
The canonical SMILES for diphenylstibane;2-ethylhexanoate is CCCCC(CC)C(=O)[O-].c1ccc([SbH]c2ccccc2)cc1.
What is the InChIKey of diphenylstibane;2-ethylhexanoate?
The InChIKey is TVTKADOYGNSSRT-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H16O2.2C6H5.Sb.H/c1-3-5-6-7(4-2)8(9)10;2*1-2-4-6-5-3-1;;/h7H,3-6H2,1-2H3,(H,9,10);2*1-5H;;/p-1.
What are the key properties of diphenylstibane;2-ethylhexanoate?
diphenylstibane;2-ethylhexanoate has a molecular weight of 420.19 g/mol, XLogP of 2.03, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for diphenylstibane;2-ethylhexanoate is sourced from PubChem (CID 20835772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).