About 3-hexan-2-ylthiophene
3-hexan-2-ylthiophene (PubChem CID 18454785) has the molecular formula C10H16S
and a molecular weight of 168.31 g/mol. Its IUPAC name is 3-hexan-2-ylthiophene.
Molecular Properties
| Compound Name | 3-hexan-2-ylthiophene |
| PubChem CID | 18454785 |
| Molecular Formula | C10H16S |
| Molecular Weight | 168.31 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | 3-hexan-2-ylthiophene |
| SMILES | CCCCC(C)c1ccsc1 |
| InChI | InChI=1S/C10H16S/c1-3-4-5-9(2)10-6-7-11-8-10/h6-9H,3-5H2,1-2H3 |
| InChIKey | KQNXYSABVOQAGB-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.31 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-hexan-2-ylthiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hexan-2-ylthiophene?
The IUPAC name of 3-hexan-2-ylthiophene (CID 18454785) is 3-hexan-2-ylthiophene.
What is the SMILES notation for 3-hexan-2-ylthiophene?
The canonical SMILES for 3-hexan-2-ylthiophene is CCCCC(C)c1ccsc1.
What is the InChIKey of 3-hexan-2-ylthiophene?
The InChIKey is KQNXYSABVOQAGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16S/c1-3-4-5-9(2)10-6-7-11-8-10/h6-9H,3-5H2,1-2H3.
What are the key properties of 3-hexan-2-ylthiophene?
3-hexan-2-ylthiophene has a molecular weight of 168.31 g/mol, XLogP of 4.04, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hexan-2-ylthiophene is sourced from PubChem (CID 18454785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).