About S-methyl 2-(1,3-dithian-2-ylidenemethyl)dodecanethioate
S-methyl 2-(1,3-dithian-2-ylidenemethyl)dodecanethioate (PubChem CID 102103693) has the molecular formula C18H32OS3
and a molecular weight of 360.65 g/mol. Its IUPAC name is S-methyl 2-(1,3-dithian-2-ylidenemethyl)dodecanethioate.
Molecular Properties
| Compound Name | S-methyl 2-(1,3-dithian-2-ylidenemethyl)dodecanethioate |
| PubChem CID | 102103693 |
| Molecular Formula | C18H32OS3 |
| Molecular Weight | 360.65 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | S-methyl 2-(1,3-dithian-2-ylidenemethyl)dodecanethioate |
| SMILES | CCCCCCCCCCC(C=C1SCCCS1)C(=O)SC |
| InChI | InChI=1S/C18H32OS3/c1-3-4-5-6-7-8-9-10-12-16(18(19)20-2)15-17-21-13-11-14-22-17/h15-16H,3-14H2,1-2H3 |
| InChIKey | QHBLFNCJDACYFS-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 360.65 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-methyl 2-(1,3-dithian-2-ylidenemethyl)dodecanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-methyl 2-(1,3-dithian-2-ylidenemethyl)dodecanethioate?
The IUPAC name of S-methyl 2-(1,3-dithian-2-ylidenemethyl)dodecanethioate (CID 102103693) is S-methyl 2-(1,3-dithian-2-ylidenemethyl)dodecanethioate.
What is the SMILES notation for S-methyl 2-(1,3-dithian-2-ylidenemethyl)dodecanethioate?
The canonical SMILES for S-methyl 2-(1,3-dithian-2-ylidenemethyl)dodecanethioate is CCCCCCCCCCC(C=C1SCCCS1)C(=O)SC.
What is the InChIKey of S-methyl 2-(1,3-dithian-2-ylidenemethyl)dodecanethioate?
The InChIKey is QHBLFNCJDACYFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H32OS3/c1-3-4-5-6-7-8-9-10-12-16(18(19)20-2)15-17-21-13-11-14-22-17/h15-16H,3-14H2,1-2H3.
What are the key properties of S-methyl 2-(1,3-dithian-2-ylidenemethyl)dodecanethioate?
S-methyl 2-(1,3-dithian-2-ylidenemethyl)dodecanethioate has a molecular weight of 360.65 g/mol, XLogP of 6.73, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-methyl 2-(1,3-dithian-2-ylidenemethyl)dodecanethioate is sourced from PubChem (CID 102103693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).