C15H29N — CID 143716521
4-methyl-5-nonan-2-yl-1,2,3,6-tetrahydropyridine (PubChem CID 143716521) has the molecular formula C15H29N and a molecular weight of 223.40 g/mol. Its IUPAC name is 4-methyl-5-nonan-2-yl-1,2,3,6-tetrahydropyridine.
| Compound Name | 4-methyl-5-nonan-2-yl-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 143716521 |
| Molecular Formula | C15H29N |
| Molecular Weight | 223.40 g/mol |
| Exact Mass | 223.23 |
| IUPAC Name | 4-methyl-5-nonan-2-yl-1,2,3,6-tetrahydropyridine |
| SMILES | CCCCCCCC(C)C1=C(C)CCNC1 |
| InChI | InChI=1S/C15H29N/c1-4-5-6-7-8-9-13(2)15-12-16-11-10-14(15)3/h13,16H,4-12H2,1-3H3 |
| InChIKey | GEBYELBUVACRIX-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.40 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|