C19H37N3 — CID 170445372
2-tridecan-7-yl-2,3,4,5,6,7-hexahydro-1H-imidazo[4,5-c]pyridine (PubChem CID 170445372) has the molecular formula C19H37N3 and a molecular weight of 307.53 g/mol. Its IUPAC name is 2-tridecan-7-yl-2,3,4,5,6,7-hexahydro-1H-imidazo[4,5-c]pyridine.
| Compound Name | 2-tridecan-7-yl-2,3,4,5,6,7-hexahydro-1H-imidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 170445372 |
| Molecular Formula | C19H37N3 |
| Molecular Weight | 307.53 g/mol |
| Exact Mass | 307.30 |
| IUPAC Name | 2-tridecan-7-yl-2,3,4,5,6,7-hexahydro-1H-imidazo[4,5-c]pyridine |
| SMILES | CCCCCCC(CCCCCC)C1NC2=C(CNCC2)N1 |
| InChI | InChI=1S/C19H37N3/c1-3-5-7-9-11-16(12-10-8-6-4-2)19-21-17-13-14-20-15-18(17)22-19/h16,19-22H,3-15H2,1-2H3 |
| InChIKey | KIJAGRRZAGIERJ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.53 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|