About 4-decan-3-ylpyrimidine
4-decan-3-ylpyrimidine (PubChem CID 170150821) has the molecular formula C14H24N2
and a molecular weight of 220.36 g/mol. Its IUPAC name is 4-decan-3-ylpyrimidine.
Molecular Properties
| Compound Name | 4-decan-3-ylpyrimidine |
| PubChem CID | 170150821 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | 4-decan-3-ylpyrimidine |
| SMILES | CCCCCCCC(CC)c1ccncn1 |
| InChI | InChI=1S/C14H24N2/c1-3-5-6-7-8-9-13(4-2)14-10-11-15-12-16-14/h10-13H,3-9H2,1-2H3 |
| InChIKey | JOCHPEKCBJFEGO-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-decan-3-ylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-decan-3-ylpyrimidine?
The IUPAC name of 4-decan-3-ylpyrimidine (CID 170150821) is 4-decan-3-ylpyrimidine.
What is the SMILES notation for 4-decan-3-ylpyrimidine?
The canonical SMILES for 4-decan-3-ylpyrimidine is CCCCCCCC(CC)c1ccncn1.
What is the InChIKey of 4-decan-3-ylpyrimidine?
The InChIKey is JOCHPEKCBJFEGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24N2/c1-3-5-6-7-8-9-13(4-2)14-10-11-15-12-16-14/h10-13H,3-9H2,1-2H3.
What are the key properties of 4-decan-3-ylpyrimidine?
4-decan-3-ylpyrimidine has a molecular weight of 220.36 g/mol, XLogP of 4.33, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-decan-3-ylpyrimidine is sourced from PubChem (CID 170150821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).