C11H20S — CID 100984300
5-heptan-3-yl-2,3-dihydrothiophene (PubChem CID 100984300) has the molecular formula C11H20S and a molecular weight of 184.35 g/mol. Its IUPAC name is 5-heptan-3-yl-2,3-dihydrothiophene.
| Compound Name | 5-heptan-3-yl-2,3-dihydrothiophene |
|---|---|
| PubChem CID | 100984300 |
| Molecular Formula | C11H20S |
| Molecular Weight | 184.35 g/mol |
| Exact Mass | 184.13 |
| IUPAC Name | 5-heptan-3-yl-2,3-dihydrothiophene |
| SMILES | CCCCC(CC)C1=CCCS1 |
| InChI | InChI=1S/C11H20S/c1-3-5-7-10(4-2)11-8-6-9-12-11/h8,10H,3-7,9H2,1-2H3 |
| InChIKey | HDNSBEBZLDGFIO-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.35 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |