C12H24N2S — CID 156888648
ethane;5-heptan-3-yl-1,3-thiazol-2-amine (PubChem CID 156888648) has the molecular formula C12H24N2S and a molecular weight of 228.40 g/mol. Its IUPAC name is ethane;5-heptan-3-yl-1,3-thiazol-2-amine.
| Compound Name | ethane;5-heptan-3-yl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 156888648 |
| Molecular Formula | C12H24N2S |
| Molecular Weight | 228.40 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | ethane;5-heptan-3-yl-1,3-thiazol-2-amine |
| SMILES | CC.CCCCC(CC)c1cnc(N)s1 |
| InChI | InChI=1S/C10H18N2S.C2H6/c1-3-5-6-8(4-2)9-7-12-10(11)13-9;1-2/h7-8H,3-6H2,1-2H3,(H2,11,12);1-2H3 |
| InChIKey | QLEGVGDKIKYBJL-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.40 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |