C16H27BN2OS — CID 174020284
CID 174020284 (PubChem CID 174020284) has the molecular formula C16H27BN2OS and a molecular weight of 306.28 g/mol.
| Compound Name | CID 174020284 |
|---|---|
| PubChem CID | 174020284 |
| Molecular Formula | C16H27BN2OS |
| Molecular Weight | 306.28 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | — |
| SMILES | [B]C(=O)Nc1ncc(C(CCCCC)CCCCCC)s1 |
| InChI | InChI=1S/C16H27BN2OS/c1-3-5-7-9-11-13(10-8-6-4-2)14-12-18-16(21-14)19-15(17)20/h12-13H,3-11H2,1-2H3,(H,18,19,20) |
| InChIKey | JXNKEBAINGZDBW-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.28 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|