C19H33N3O2S — CID 5146409
N-(3-methylbutyl)-N-[2-[(5-methyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]octanamide (PubChem CID 5146409) has the molecular formula C19H33N3O2S and a molecular weight of 367.56 g/mol. Its IUPAC name is N-(3-methylbutyl)-N-[2-[(5-methyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]octanamide.
| Compound Name | N-(3-methylbutyl)-N-[2-[(5-methyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]octanamide |
|---|---|
| PubChem CID | 5146409 |
| Molecular Formula | C19H33N3O2S |
| Molecular Weight | 367.56 g/mol |
| Exact Mass | 367.23 |
| IUPAC Name | N-(3-methylbutyl)-N-[2-[(5-methyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]octanamide |
| SMILES | CCCCCCCC(=O)N(CCC(C)C)CC(=O)Nc1ncc(C)s1 |
| InChI | InChI=1S/C19H33N3O2S/c1-5-6-7-8-9-10-18(24)22(12-11-15(2)3)14-17(23)21-19-20-13-16(4)25-19/h13,15H,5-12,14H2,1-4H3,(H,20,21,23) |
| InChIKey | RWSZAJJYDQXTEN-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.56 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|