C21H29N3O2S — CID 42770867
N-[2-[(5-methyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]-N-pentyl-2-phenylbutanamide (PubChem CID 42770867) has the molecular formula C21H29N3O2S and a molecular weight of 387.55 g/mol. Its IUPAC name is N-[2-[(5-methyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]-N-pentyl-2-phenylbutanamide.
| Compound Name | N-[2-[(5-methyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]-N-pentyl-2-phenylbutanamide |
|---|---|
| PubChem CID | 42770867 |
| Molecular Formula | C21H29N3O2S |
| Molecular Weight | 387.55 g/mol |
| Exact Mass | 387.20 |
| IUPAC Name | N-[2-[(5-methyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]-N-pentyl-2-phenylbutanamide |
| SMILES | CCCCCN(CC(=O)Nc1ncc(C)s1)C(=O)C(CC)c1ccccc1 |
| InChI | InChI=1S/C21H29N3O2S/c1-4-6-10-13-24(15-19(25)23-21-22-14-16(3)27-21)20(26)18(5-2)17-11-8-7-9-12-17/h7-9,11-12,14,18H,4-6,10,13,15H2,1-3H3,(H,22,23,25) |
| InChIKey | KNEMGOTVYVGVHB-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.55 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|