C18H22FN3O2S — CID 4145952
4-fluoro-N-[2-[(5-methyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]-N-pentylbenzamide (PubChem CID 4145952) has the molecular formula C18H22FN3O2S and a molecular weight of 363.46 g/mol. Its IUPAC name is 4-fluoro-N-[2-[(5-methyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]-N-pentylbenzamide.
| Compound Name | 4-fluoro-N-[2-[(5-methyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]-N-pentylbenzamide |
|---|---|
| PubChem CID | 4145952 |
| Molecular Formula | C18H22FN3O2S |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | 4-fluoro-N-[2-[(5-methyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]-N-pentylbenzamide |
| SMILES | CCCCCN(CC(=O)Nc1ncc(C)s1)C(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H22FN3O2S/c1-3-4-5-10-22(17(24)14-6-8-15(19)9-7-14)12-16(23)21-18-20-11-13(2)25-18/h6-9,11H,3-5,10,12H2,1-2H3,(H,20,21,23) |
| InChIKey | XLCCBHQXMISCGC-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|