C23H33N3O2S — CID 42663876
N-butan-2-yl-4-hexyl-N-[2-[(5-methyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]benzamide (PubChem CID 42663876) has the molecular formula C23H33N3O2S and a molecular weight of 415.60 g/mol. Its IUPAC name is N-butan-2-yl-4-hexyl-N-[2-[(5-methyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]benzamide.
| Compound Name | N-butan-2-yl-4-hexyl-N-[2-[(5-methyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 42663876 |
| Molecular Formula | C23H33N3O2S |
| Molecular Weight | 415.60 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | N-butan-2-yl-4-hexyl-N-[2-[(5-methyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]benzamide |
| SMILES | CCCCCCc1ccc(C(=O)N(CC(=O)Nc2ncc(C)s2)C(C)CC)cc1 |
| InChI | InChI=1S/C23H33N3O2S/c1-5-7-8-9-10-19-11-13-20(14-12-19)22(28)26(17(3)6-2)16-21(27)25-23-24-15-18(4)29-23/h11-15,17H,5-10,16H2,1-4H3,(H,24,25,27) |
| InChIKey | OUGMRKLZCACHBH-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.60 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|