C23H31N3O2S — CID 5200011
N-cyclopropyl-N-[2-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]-4-hexylbenzamide (PubChem CID 5200011) has the molecular formula C23H31N3O2S and a molecular weight of 413.59 g/mol. Its IUPAC name is N-cyclopropyl-N-[2-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]-4-hexylbenzamide.
| Compound Name | N-cyclopropyl-N-[2-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]-4-hexylbenzamide |
|---|---|
| PubChem CID | 5200011 |
| Molecular Formula | C23H31N3O2S |
| Molecular Weight | 413.59 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | N-cyclopropyl-N-[2-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]-4-hexylbenzamide |
| SMILES | CCCCCCc1ccc(C(=O)N(CC(=O)Nc2nc(C)c(C)s2)C2CC2)cc1 |
| InChI | InChI=1S/C23H31N3O2S/c1-4-5-6-7-8-18-9-11-19(12-10-18)22(28)26(20-13-14-20)15-21(27)25-23-24-16(2)17(3)29-23/h9-12,20H,4-8,13-15H2,1-3H3,(H,24,25,27) |
| InChIKey | BGTQHBYWMNMGJB-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.59 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|