C20H24N4O4S — CID 4068709
N-cyclohexyl-N-[2-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]-4-nitrobenzamide (PubChem CID 4068709) has the molecular formula C20H24N4O4S and a molecular weight of 416.50 g/mol. Its IUPAC name is N-cyclohexyl-N-[2-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]-4-nitrobenzamide.
| Compound Name | N-cyclohexyl-N-[2-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 4068709 |
| Molecular Formula | C20H24N4O4S |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | N-cyclohexyl-N-[2-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]-4-nitrobenzamide |
| SMILES | Cc1nc(NC(=O)CN(C(=O)c2ccc([N+](=O)[O-])cc2)C2CCCCC2)sc1C |
| InChI | InChI=1S/C20H24N4O4S/c1-13-14(2)29-20(21-13)22-18(25)12-23(16-6-4-3-5-7-16)19(26)15-8-10-17(11-9-15)24(27)28/h8-11,16H,3-7,12H2,1-2H3,(H,21,22,25) |
| InChIKey | YCDSXJZEQFHTSX-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 105.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|