C19H21ClN4O5S — CID 5145350
4-chloro-N-[2-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]-3-nitro-N-(oxolan-2-ylmethyl)benzamide (PubChem CID 5145350) has the molecular formula C19H21ClN4O5S and a molecular weight of 452.92 g/mol. Its IUPAC name is 4-chloro-N-[2-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]-3-nitro-N-(oxolan-2-ylmethyl)benzamide.
| Compound Name | 4-chloro-N-[2-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]-3-nitro-N-(oxolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 5145350 |
| Molecular Formula | C19H21ClN4O5S |
| Molecular Weight | 452.92 g/mol |
| Exact Mass | 452.09 |
| IUPAC Name | 4-chloro-N-[2-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]-3-nitro-N-(oxolan-2-ylmethyl)benzamide |
| SMILES | Cc1nc(NC(=O)CN(CC2CCCO2)C(=O)c2ccc(Cl)c([N+](=O)[O-])c2)sc1C |
| InChI | InChI=1S/C19H21ClN4O5S/c1-11-12(2)30-19(21-11)22-17(25)10-23(9-14-4-3-7-29-14)18(26)13-5-6-15(20)16(8-13)24(27)28/h5-6,8,14H,3-4,7,9-10H2,1-2H3,(H,21,22,25) |
| InChIKey | LSQGZQCGWAPOLR-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 114.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.92 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|