C21H26N4O4S — CID 4523802
N-(cyclohexylmethyl)-4-methyl-N-[2-[(4-methyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]-3-nitrobenzamide (PubChem CID 4523802) has the molecular formula C21H26N4O4S and a molecular weight of 430.53 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-4-methyl-N-[2-[(4-methyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]-3-nitrobenzamide.
| Compound Name | N-(cyclohexylmethyl)-4-methyl-N-[2-[(4-methyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 4523802 |
| Molecular Formula | C21H26N4O4S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | N-(cyclohexylmethyl)-4-methyl-N-[2-[(4-methyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]-3-nitrobenzamide |
| SMILES | Cc1csc(NC(=O)CN(CC2CCCCC2)C(=O)c2ccc(C)c([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C21H26N4O4S/c1-14-8-9-17(10-18(14)25(28)29)20(27)24(11-16-6-4-3-5-7-16)12-19(26)23-21-22-15(2)13-30-21/h8-10,13,16H,3-7,11-12H2,1-2H3,(H,22,23,26) |
| InChIKey | QHTXCMLIXWIYHG-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 105.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|