C18H22N4O4S — CID 3460973
N-(3-methylbutyl)-N-[2-[(4-methyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]-4-nitrobenzamide (PubChem CID 3460973) has the molecular formula C18H22N4O4S and a molecular weight of 390.47 g/mol. Its IUPAC name is N-(3-methylbutyl)-N-[2-[(4-methyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]-4-nitrobenzamide.
| Compound Name | N-(3-methylbutyl)-N-[2-[(4-methyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 3460973 |
| Molecular Formula | C18H22N4O4S |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | N-(3-methylbutyl)-N-[2-[(4-methyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]-4-nitrobenzamide |
| SMILES | Cc1csc(NC(=O)CN(CCC(C)C)C(=O)c2ccc([N+](=O)[O-])cc2)n1 |
| InChI | InChI=1S/C18H22N4O4S/c1-12(2)8-9-21(10-16(23)20-18-19-13(3)11-27-18)17(24)14-4-6-15(7-5-14)22(25)26/h4-7,11-12H,8-10H2,1-3H3,(H,19,20,23) |
| InChIKey | WJOHZNYIQIRZHC-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 105.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|