C19H23N5O5S — CID 5112886
N-[2-[(4-methyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]-N-(2-morpholin-4-ylethyl)-3-nitrobenzamide (PubChem CID 5112886) has the molecular formula C19H23N5O5S and a molecular weight of 433.49 g/mol. Its IUPAC name is N-[2-[(4-methyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]-N-(2-morpholin-4-ylethyl)-3-nitrobenzamide.
| Compound Name | N-[2-[(4-methyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]-N-(2-morpholin-4-ylethyl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 5112886 |
| Molecular Formula | C19H23N5O5S |
| Molecular Weight | 433.49 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | N-[2-[(4-methyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]-N-(2-morpholin-4-ylethyl)-3-nitrobenzamide |
| SMILES | Cc1csc(NC(=O)CN(CCN2CCOCC2)C(=O)c2cccc([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C19H23N5O5S/c1-14-13-30-19(20-14)21-17(25)12-23(6-5-22-7-9-29-10-8-22)18(26)15-3-2-4-16(11-15)24(27)28/h2-4,11,13H,5-10,12H2,1H3,(H,20,21,25) |
| InChIKey | ICQWPGXIMVRROP-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 117.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.49 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|