C20H35N3O2S — CID 4188240
N-(3-methylbutyl)-N-[2-[(4-methyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]nonanamide (PubChem CID 4188240) has the molecular formula C20H35N3O2S and a molecular weight of 381.59 g/mol. Its IUPAC name is N-(3-methylbutyl)-N-[2-[(4-methyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]nonanamide.
| Compound Name | N-(3-methylbutyl)-N-[2-[(4-methyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]nonanamide |
|---|---|
| PubChem CID | 4188240 |
| Molecular Formula | C20H35N3O2S |
| Molecular Weight | 381.59 g/mol |
| Exact Mass | 381.24 |
| IUPAC Name | N-(3-methylbutyl)-N-[2-[(4-methyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]nonanamide |
| SMILES | CCCCCCCCC(=O)N(CCC(C)C)CC(=O)Nc1nc(C)cs1 |
| InChI | InChI=1S/C20H35N3O2S/c1-5-6-7-8-9-10-11-19(25)23(13-12-16(2)3)14-18(24)22-20-21-17(4)15-26-20/h15-16H,5-14H2,1-4H3,(H,21,22,24) |
| InChIKey | CDRXOUMTNXCZEB-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.59 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|