C18H32N4O2S — CID 3558431
N-[2-(dimethylamino)ethyl]-N-[2-[(4-methyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]octanamide (PubChem CID 3558431) has the molecular formula C18H32N4O2S and a molecular weight of 368.55 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-N-[2-[(4-methyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]octanamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-N-[2-[(4-methyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]octanamide |
|---|---|
| PubChem CID | 3558431 |
| Molecular Formula | C18H32N4O2S |
| Molecular Weight | 368.55 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-N-[2-[(4-methyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]octanamide |
| SMILES | CCCCCCCC(=O)N(CCN(C)C)CC(=O)Nc1nc(C)cs1 |
| InChI | InChI=1S/C18H32N4O2S/c1-5-6-7-8-9-10-17(24)22(12-11-21(3)4)13-16(23)20-18-19-15(2)14-25-18/h14H,5-13H2,1-4H3,(H,19,20,23) |
| InChIKey | HPQGZXVUOBVVOL-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.55 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|