C22H31N3O4S — CID 42771492
4-butoxy-N-[2-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]-N-(3-methoxypropyl)benzamide (PubChem CID 42771492) has the molecular formula C22H31N3O4S and a molecular weight of 433.57 g/mol. Its IUPAC name is 4-butoxy-N-[2-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]-N-(3-methoxypropyl)benzamide.
| Compound Name | 4-butoxy-N-[2-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]-N-(3-methoxypropyl)benzamide |
|---|---|
| PubChem CID | 42771492 |
| Molecular Formula | C22H31N3O4S |
| Molecular Weight | 433.57 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | 4-butoxy-N-[2-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]-N-(3-methoxypropyl)benzamide |
| SMILES | CCCCOc1ccc(C(=O)N(CCCOC)CC(=O)Nc2nc(C)c(C)s2)cc1 |
| InChI | InChI=1S/C22H31N3O4S/c1-5-6-14-29-19-10-8-18(9-11-19)21(27)25(12-7-13-28-4)15-20(26)24-22-23-16(2)17(3)30-22/h8-11H,5-7,12-15H2,1-4H3,(H,23,24,26) |
| InChIKey | AODGOTFXOREUOD-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.57 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|