C26H35N3O5 — CID 4051876
4-butyl-N-[2-[[2-(4-methoxyanilino)-2-oxoethyl]amino]-2-oxoethyl]-N-(3-methoxypropyl)benzamide (PubChem CID 4051876) has the molecular formula C26H35N3O5 and a molecular weight of 469.58 g/mol. Its IUPAC name is 4-butyl-N-[2-[[2-(4-methoxyanilino)-2-oxoethyl]amino]-2-oxoethyl]-N-(3-methoxypropyl)benzamide.
| Compound Name | 4-butyl-N-[2-[[2-(4-methoxyanilino)-2-oxoethyl]amino]-2-oxoethyl]-N-(3-methoxypropyl)benzamide |
|---|---|
| PubChem CID | 4051876 |
| Molecular Formula | C26H35N3O5 |
| Molecular Weight | 469.58 g/mol |
| Exact Mass | 469.26 |
| IUPAC Name | 4-butyl-N-[2-[[2-(4-methoxyanilino)-2-oxoethyl]amino]-2-oxoethyl]-N-(3-methoxypropyl)benzamide |
| SMILES | CCCCc1ccc(C(=O)N(CCCOC)CC(=O)NCC(=O)Nc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C26H35N3O5/c1-4-5-7-20-8-10-21(11-9-20)26(32)29(16-6-17-33-2)19-25(31)27-18-24(30)28-22-12-14-23(34-3)15-13-22/h8-15H,4-7,16-19H2,1-3H3,(H,27,31)(H,28,30) |
| InChIKey | HZHNWIQEPMZDNB-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.58 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|