C23H37N3O4 — CID 4167862
N-butyl-N-[2-[[2-(4-methoxyanilino)-2-oxoethyl]amino]-2-oxoethyl]octanamide (PubChem CID 4167862) has the molecular formula C23H37N3O4 and a molecular weight of 419.57 g/mol. Its IUPAC name is N-butyl-N-[2-[[2-(4-methoxyanilino)-2-oxoethyl]amino]-2-oxoethyl]octanamide.
| Compound Name | N-butyl-N-[2-[[2-(4-methoxyanilino)-2-oxoethyl]amino]-2-oxoethyl]octanamide |
|---|---|
| PubChem CID | 4167862 |
| Molecular Formula | C23H37N3O4 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.28 |
| IUPAC Name | N-butyl-N-[2-[[2-(4-methoxyanilino)-2-oxoethyl]amino]-2-oxoethyl]octanamide |
| SMILES | CCCCCCCC(=O)N(CCCC)CC(=O)NCC(=O)Nc1ccc(OC)cc1 |
| InChI | InChI=1S/C23H37N3O4/c1-4-6-8-9-10-11-23(29)26(16-7-5-2)18-22(28)24-17-21(27)25-19-12-14-20(30-3)15-13-19/h12-15H,4-11,16-18H2,1-3H3,(H,24,28)(H,25,27) |
| InChIKey | LOKYCAFCTADCPO-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|