C24H39N3O3 — CID 3439279
N-[2-[[2-(4-methylanilino)-2-oxoethyl]amino]-2-oxoethyl]-N-(2-methylpropyl)nonanamide (PubChem CID 3439279) has the molecular formula C24H39N3O3 and a molecular weight of 417.59 g/mol. Its IUPAC name is N-[2-[[2-(4-methylanilino)-2-oxoethyl]amino]-2-oxoethyl]-N-(2-methylpropyl)nonanamide.
| Compound Name | N-[2-[[2-(4-methylanilino)-2-oxoethyl]amino]-2-oxoethyl]-N-(2-methylpropyl)nonanamide |
|---|---|
| PubChem CID | 3439279 |
| Molecular Formula | C24H39N3O3 |
| Molecular Weight | 417.59 g/mol |
| Exact Mass | 417.30 |
| IUPAC Name | N-[2-[[2-(4-methylanilino)-2-oxoethyl]amino]-2-oxoethyl]-N-(2-methylpropyl)nonanamide |
| SMILES | CCCCCCCCC(=O)N(CC(=O)NCC(=O)Nc1ccc(C)cc1)CC(C)C |
| InChI | InChI=1S/C24H39N3O3/c1-5-6-7-8-9-10-11-24(30)27(17-19(2)3)18-23(29)25-16-22(28)26-21-14-12-20(4)13-15-21/h12-15,19H,5-11,16-18H2,1-4H3,(H,25,29)(H,26,28) |
| InChIKey | RQSBBYYBOTZJMA-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.59 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|