C20H31N3O5 — CID 5087215
N-[2-[[2-(4-methoxyanilino)-2-oxoethyl]amino]-2-oxoethyl]-N-(3-methoxypropyl)pentanamide (PubChem CID 5087215) has the molecular formula C20H31N3O5 and a molecular weight of 393.48 g/mol. Its IUPAC name is N-[2-[[2-(4-methoxyanilino)-2-oxoethyl]amino]-2-oxoethyl]-N-(3-methoxypropyl)pentanamide.
| Compound Name | N-[2-[[2-(4-methoxyanilino)-2-oxoethyl]amino]-2-oxoethyl]-N-(3-methoxypropyl)pentanamide |
|---|---|
| PubChem CID | 5087215 |
| Molecular Formula | C20H31N3O5 |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | N-[2-[[2-(4-methoxyanilino)-2-oxoethyl]amino]-2-oxoethyl]-N-(3-methoxypropyl)pentanamide |
| SMILES | CCCCC(=O)N(CCCOC)CC(=O)NCC(=O)Nc1ccc(OC)cc1 |
| InChI | InChI=1S/C20H31N3O5/c1-4-5-7-20(26)23(12-6-13-27-2)15-19(25)21-14-18(24)22-16-8-10-17(28-3)11-9-16/h8-11H,4-7,12-15H2,1-3H3,(H,21,25)(H,22,24) |
| InChIKey | JEJVEMDSEGKOHQ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|