C25H33N3O5 — CID 3405435
4-butoxy-N-(2-methoxyethyl)-N-[2-[[2-(4-methylanilino)-2-oxoethyl]amino]-2-oxoethyl]benzamide (PubChem CID 3405435) has the molecular formula C25H33N3O5 and a molecular weight of 455.56 g/mol. Its IUPAC name is 4-butoxy-N-(2-methoxyethyl)-N-[2-[[2-(4-methylanilino)-2-oxoethyl]amino]-2-oxoethyl]benzamide.
| Compound Name | 4-butoxy-N-(2-methoxyethyl)-N-[2-[[2-(4-methylanilino)-2-oxoethyl]amino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 3405435 |
| Molecular Formula | C25H33N3O5 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.24 |
| IUPAC Name | 4-butoxy-N-(2-methoxyethyl)-N-[2-[[2-(4-methylanilino)-2-oxoethyl]amino]-2-oxoethyl]benzamide |
| SMILES | CCCCOc1ccc(C(=O)N(CCOC)CC(=O)NCC(=O)Nc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C25H33N3O5/c1-4-5-15-33-22-12-8-20(9-13-22)25(31)28(14-16-32-3)18-24(30)26-17-23(29)27-21-10-6-19(2)7-11-21/h6-13H,4-5,14-18H2,1-3H3,(H,26,30)(H,27,29) |
| InChIKey | QZWYWUCWCXLPIR-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|