C21H33N3O4 — CID 4555666
2-ethyl-N-(3-methoxypropyl)-N-[2-[[2-(4-methylanilino)-2-oxoethyl]amino]-2-oxoethyl]butanamide (PubChem CID 4555666) has the molecular formula C21H33N3O4 and a molecular weight of 391.51 g/mol. Its IUPAC name is 2-ethyl-N-(3-methoxypropyl)-N-[2-[[2-(4-methylanilino)-2-oxoethyl]amino]-2-oxoethyl]butanamide.
| Compound Name | 2-ethyl-N-(3-methoxypropyl)-N-[2-[[2-(4-methylanilino)-2-oxoethyl]amino]-2-oxoethyl]butanamide |
|---|---|
| PubChem CID | 4555666 |
| Molecular Formula | C21H33N3O4 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.25 |
| IUPAC Name | 2-ethyl-N-(3-methoxypropyl)-N-[2-[[2-(4-methylanilino)-2-oxoethyl]amino]-2-oxoethyl]butanamide |
| SMILES | CCC(CC)C(=O)N(CCCOC)CC(=O)NCC(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C21H33N3O4/c1-5-17(6-2)21(27)24(12-7-13-28-4)15-20(26)22-14-19(25)23-18-10-8-16(3)9-11-18/h8-11,17H,5-7,12-15H2,1-4H3,(H,22,26)(H,23,25) |
| InChIKey | MARPGFIRMBCXRN-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|