C23H37N3O3 — CID 7330763
(2R)-N-butyl-2-ethyl-N-[2-[[2-(4-methylanilino)-2-oxoethyl]amino]-2-oxoethyl]hexanamide (PubChem CID 7330763) has the molecular formula C23H37N3O3 and a molecular weight of 403.57 g/mol. Its IUPAC name is (2R)-N-butyl-2-ethyl-N-[2-[[2-(4-methylanilino)-2-oxoethyl]amino]-2-oxoethyl]hexanamide.
| Compound Name | (2R)-N-butyl-2-ethyl-N-[2-[[2-(4-methylanilino)-2-oxoethyl]amino]-2-oxoethyl]hexanamide |
|---|---|
| PubChem CID | 7330763 |
| Molecular Formula | C23H37N3O3 |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.28 |
| IUPAC Name | (2R)-N-butyl-2-ethyl-N-[2-[[2-(4-methylanilino)-2-oxoethyl]amino]-2-oxoethyl]hexanamide |
| SMILES | CCCC[C@@H](CC)C(=O)N(CCCC)CC(=O)NCC(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C23H37N3O3/c1-5-8-10-19(7-3)23(29)26(15-9-6-2)17-22(28)24-16-21(27)25-20-13-11-18(4)12-14-20/h11-14,19H,5-10,15-17H2,1-4H3,(H,24,28)(H,25,27)/t19-/m1/s1 |
| InChIKey | JKXIJZHLWGUOOG-LJQANCHMSA-N |
| XLogP | 3.89 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |