C8H16N2S — CID 178111483
ethane;5-propan-2-yl-1,3-thiazol-2-amine (PubChem CID 178111483) has the molecular formula C8H16N2S and a molecular weight of 172.30 g/mol. Its IUPAC name is ethane;5-propan-2-yl-1,3-thiazol-2-amine.
| Compound Name | ethane;5-propan-2-yl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 178111483 |
| Molecular Formula | C8H16N2S |
| Molecular Weight | 172.30 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | ethane;5-propan-2-yl-1,3-thiazol-2-amine |
| SMILES | CC.CC(C)c1cnc(N)s1 |
| InChI | InChI=1S/C6H10N2S.C2H6/c1-4(2)5-3-8-6(7)9-5;1-2/h3-4H,1-2H3,(H2,7,8);1-2H3 |
| InChIKey | LIOWDBXUJVKMIW-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.30 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |